C18H25ClFN3OS — CID 67286330
2-[2-tert-butyl-5-(4-chloro-2-fluorophenyl)-2-hydroxyhexyl]-1H-1,2,4-triazole-3-thione (PubChem CID 67286330) has the molecular formula C18H25ClFN3OS and a molecular weight of 385.94 g/mol. Its IUPAC name is 2-[2-tert-butyl-5-(4-chloro-2-fluorophenyl)-2-hydroxyhexyl]-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-[2-tert-butyl-5-(4-chloro-2-fluorophenyl)-2-hydroxyhexyl]-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 67286330 |
| Molecular Formula | C18H25ClFN3OS |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-[2-tert-butyl-5-(4-chloro-2-fluorophenyl)-2-hydroxyhexyl]-1H-1,2,4-triazole-3-thione |
| SMILES | CC(CCC(O)(Cn1[nH]cnc1=S)C(C)(C)C)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C18H25ClFN3OS/c1-12(14-6-5-13(19)9-15(14)20)7-8-18(24,17(2,3)4)10-23-16(25)21-11-22-23/h5-6,9,11-12,24H,7-8,10H2,1-4H3,(H,21,22,25) |
| InChIKey | WDJWHZGBAFKEHT-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|