C18H25Cl2N3OS — CID 67285067
2-[2-tert-butyl-6-(2,4-dichlorophenoxy)hexyl]-1H-1,2,4-triazole-3-thione (PubChem CID 67285067) has the molecular formula C18H25Cl2N3OS and a molecular weight of 402.39 g/mol. Its IUPAC name is 2-[2-tert-butyl-6-(2,4-dichlorophenoxy)hexyl]-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-[2-tert-butyl-6-(2,4-dichlorophenoxy)hexyl]-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 67285067 |
| Molecular Formula | C18H25Cl2N3OS |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 2-[2-tert-butyl-6-(2,4-dichlorophenoxy)hexyl]-1H-1,2,4-triazole-3-thione |
| SMILES | CC(C)(C)C(CCCCOc1ccc(Cl)cc1Cl)Cn1[nH]cnc1=S |
| InChI | InChI=1S/C18H25Cl2N3OS/c1-18(2,3)13(11-23-17(25)21-12-22-23)6-4-5-9-24-16-8-7-14(19)10-15(16)20/h7-8,10,12-13H,4-6,9,11H2,1-3H3,(H,21,22,25) |
| InChIKey | HLMBMAPZHMCIML-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|