C18H25Cl2N3OS — CID 87139878
2-[(2S,4S,5S)-1-(2,4-dichlorophenyl)-5-hydroxy-2,6,6-trimethylheptan-4-yl]-1H-1,2,4-triazole-3-thione (PubChem CID 87139878) has the molecular formula C18H25Cl2N3OS and a molecular weight of 402.39 g/mol. Its IUPAC name is 2-[(2S,4S,5S)-1-(2,4-dichlorophenyl)-5-hydroxy-2,6,6-trimethylheptan-4-yl]-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-[(2S,4S,5S)-1-(2,4-dichlorophenyl)-5-hydroxy-2,6,6-trimethylheptan-4-yl]-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 87139878 |
| Molecular Formula | C18H25Cl2N3OS |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 2-[(2S,4S,5S)-1-(2,4-dichlorophenyl)-5-hydroxy-2,6,6-trimethylheptan-4-yl]-1H-1,2,4-triazole-3-thione |
| SMILES | C[C@@H](Cc1ccc(Cl)cc1Cl)C[C@@H]([C@@H](O)C(C)(C)C)n1[nH]cnc1=S |
| InChI | InChI=1S/C18H25Cl2N3OS/c1-11(7-12-5-6-13(19)9-14(12)20)8-15(16(24)18(2,3)4)23-17(25)21-10-22-23/h5-6,9-11,15-16,24H,7-8H2,1-4H3,(H,21,22,25)/t11-,15-,16+/m0/s1 |
| InChIKey | IYRCSBXNZXXLHZ-KNXALSJPSA-N |
| XLogP | 5.46 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|