C17H19NO4 — CID 67296605
(1S,9R,10R)-4-hydroxy-3-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,14-dione (PubChem CID 67296605) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is (1S,9R,10R)-4-hydroxy-3-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,14-dione.
| Compound Name | (1S,9R,10R)-4-hydroxy-3-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,14-dione |
|---|---|
| PubChem CID | 67296605 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (1S,9R,10R)-4-hydroxy-3-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,14-dione |
| SMILES | COc1c(O)ccc2c1[C@]13CCN[C@H](C2)[C@@H]1CCC(=O)C3=O |
| InChI | InChI=1S/C17H19NO4/c1-22-15-12(19)4-2-9-8-11-10-3-5-13(20)16(21)17(10,14(9)15)6-7-18-11/h2,4,10-11,18-19H,3,5-8H2,1H3/t10-,11+,17-/m0/s1 |
| InChIKey | DKOCJCVXGLYFTO-RVPKQNPDSA-N |
| XLogP | 1.10 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|