C30H26O9 — CID 67304318
1-[4-hydroxy-3-[1-(2-hydroxyphenyl)-1,3-dioxobutan-2-yl]oxyphenyl]-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 67304318) has the molecular formula C30H26O9 and a molecular weight of 530.53 g/mol. Its IUPAC name is 1-[4-hydroxy-3-[1-(2-hydroxyphenyl)-1,3-dioxobutan-2-yl]oxyphenyl]-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | 1-[4-hydroxy-3-[1-(2-hydroxyphenyl)-1,3-dioxobutan-2-yl]oxyphenyl]-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 67304318 |
| Molecular Formula | C30H26O9 |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | 1-[4-hydroxy-3-[1-(2-hydroxyphenyl)-1,3-dioxobutan-2-yl]oxyphenyl]-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(C=CC(=O)CC(=O)C=Cc2ccc(O)c(OC(C(C)=O)C(=O)c3ccccc3O)c2)ccc1O |
| InChI | InChI=1S/C30H26O9/c1-18(31)30(29(37)23-5-3-4-6-24(23)34)39-28-16-20(10-14-26(28)36)8-12-22(33)17-21(32)11-7-19-9-13-25(35)27(15-19)38-2/h3-16,30,34-36H,17H2,1-2H3 |
| InChIKey | CBWSGZVPXHMPTH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|