C27H20O10 — CID 175793750
4-[2-hydroxy-5-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenoxy]hepta-1,6-diene-1,3,5,7-tetrone (PubChem CID 175793750) has the molecular formula C27H20O10 and a molecular weight of 504.45 g/mol. Its IUPAC name is 4-[2-hydroxy-5-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenoxy]hepta-1,6-diene-1,3,5,7-tetrone.
| Compound Name | 4-[2-hydroxy-5-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenoxy]hepta-1,6-diene-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 175793750 |
| Molecular Formula | C27H20O10 |
| Molecular Weight | 504.45 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | 4-[2-hydroxy-5-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenoxy]hepta-1,6-diene-1,3,5,7-tetrone |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(O)c(OC(C(=O)C=C=O)C(=O)C=C=O)c2)ccc1O |
| InChI | InChI=1S/C27H20O10/c1-36-25-14-17(4-8-21(25)32)2-6-19(30)16-20(31)7-3-18-5-9-22(33)26(15-18)37-27(23(34)10-12-28)24(35)11-13-29/h2-11,14-15,27,32-33H,16H2,1H3/b6-2+,7-3+ |
| InChIKey | KNAVFCWAWFJBRJ-YPCIICBESA-N |
| XLogP | 2.02 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|