C21H28F3N3O3 — CID 67306127
5-[4-amino-3-(cyclohepten-1-yl)phenyl]-1,3-dimethyl-1,3-diazinan-2-one;2,2,2-trifluoroacetic acid (PubChem CID 67306127) has the molecular formula C21H28F3N3O3 and a molecular weight of 427.47 g/mol. Its IUPAC name is 5-[4-amino-3-(cyclohepten-1-yl)phenyl]-1,3-dimethyl-1,3-diazinan-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[4-amino-3-(cyclohepten-1-yl)phenyl]-1,3-dimethyl-1,3-diazinan-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67306127 |
| Molecular Formula | C21H28F3N3O3 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 5-[4-amino-3-(cyclohepten-1-yl)phenyl]-1,3-dimethyl-1,3-diazinan-2-one;2,2,2-trifluoroacetic acid |
| SMILES | CN1CC(c2ccc(N)c(C3=CCCCCC3)c2)CN(C)C1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H27N3O.C2HF3O2/c1-21-12-16(13-22(2)19(21)23)15-9-10-18(20)17(11-15)14-7-5-3-4-6-8-14;3-2(4,5)1(6)7/h7,9-11,16H,3-6,8,12-13,20H2,1-2H3;(H,6,7) |
| InChIKey | POJPELLYKMRBNQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|