C26H49ClFNO3SSi2 — CID 67306210
N-[(2S,3S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-(3-chloro-5-fluorophenyl)butan-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 67306210) has the molecular formula C26H49ClFNO3SSi2 and a molecular weight of 566.37 g/mol. Its IUPAC name is N-[(2S,3S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-(3-chloro-5-fluorophenyl)butan-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(2S,3S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-(3-chloro-5-fluorophenyl)butan-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 67306210 |
| Molecular Formula | C26H49ClFNO3SSi2 |
| Molecular Weight | 566.37 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | N-[(2S,3S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-(3-chloro-5-fluorophenyl)butan-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N[C@@H](Cc1cc(F)cc(Cl)c1)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H49ClFNO3SSi2/c1-24(2,3)33(30)29-22(16-19-14-20(27)17-21(28)15-19)23(32-35(12,13)26(7,8)9)18-31-34(10,11)25(4,5)6/h14-15,17,22-23,29H,16,18H2,1-13H3/t22-,23+,33?/m0/s1 |
| InChIKey | KVTGEGSOJNCUJA-JLNVSYFESA-N |
| XLogP | 7.85 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.37 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|