About iodomethyl carbamate;2-phenylethylbenzene
iodomethyl carbamate;2-phenylethylbenzene (PubChem CID 67308047) has the molecular formula C16H18INO2
and a molecular weight of 383.23 g/mol. Its IUPAC name is iodomethyl carbamate;2-phenylethylbenzene.
Molecular Properties
| Compound Name | iodomethyl carbamate;2-phenylethylbenzene |
| PubChem CID | 67308047 |
| Molecular Formula | C16H18INO2 |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | iodomethyl carbamate;2-phenylethylbenzene |
| SMILES | NC(=O)OCI.c1ccc(CCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14.C2H4INO2/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;3-1-6-2(4)5/h1-10H,11-12H2;1H2,(H2,4,5) |
| InChIKey | XGGKOCPLDIWRLQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodomethyl carbamate;2-phenylethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodomethyl carbamate;2-phenylethylbenzene?
The IUPAC name of iodomethyl carbamate;2-phenylethylbenzene (CID 67308047) is iodomethyl carbamate;2-phenylethylbenzene.
What is the SMILES notation for iodomethyl carbamate;2-phenylethylbenzene?
The canonical SMILES for iodomethyl carbamate;2-phenylethylbenzene is NC(=O)OCI.c1ccc(CCc2ccccc2)cc1.
What is the InChIKey of iodomethyl carbamate;2-phenylethylbenzene?
The InChIKey is XGGKOCPLDIWRLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.C2H4INO2/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;3-1-6-2(4)5/h1-10H,11-12H2;1H2,(H2,4,5).
What are the key properties of iodomethyl carbamate;2-phenylethylbenzene?
iodomethyl carbamate;2-phenylethylbenzene has a molecular weight of 383.23 g/mol, XLogP of 3.95, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iodomethyl carbamate;2-phenylethylbenzene is sourced from PubChem (CID 67308047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).