C10H13NO5 — CID 67310208
[2-(tert-butylcarbamoyl)furan-3-yl] hydrogen carbonate (PubChem CID 67310208) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is [2-(tert-butylcarbamoyl)furan-3-yl] hydrogen carbonate.
| Compound Name | [2-(tert-butylcarbamoyl)furan-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 67310208 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | [2-(tert-butylcarbamoyl)furan-3-yl] hydrogen carbonate |
| SMILES | CC(C)(C)NC(=O)c1occc1OC(=O)O |
| InChI | InChI=1S/C10H13NO5/c1-10(2,3)11-8(12)7-6(4-5-15-7)16-9(13)14/h4-5H,1-3H3,(H,11,12)(H,13,14) |
| InChIKey | QKDOPQZJWZVGEM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |