C28H32N6O5S — CID 67319044
1-[3-tert-butyl-1-[3-(2-methoxyethylsulfamoyl)phenyl]pyrazol-5-yl]-3-(2-pyridin-3-yloxyphenyl)urea (PubChem CID 67319044) has the molecular formula C28H32N6O5S and a molecular weight of 564.67 g/mol. Its IUPAC name is 1-[3-tert-butyl-1-[3-(2-methoxyethylsulfamoyl)phenyl]pyrazol-5-yl]-3-(2-pyridin-3-yloxyphenyl)urea.
| Compound Name | 1-[3-tert-butyl-1-[3-(2-methoxyethylsulfamoyl)phenyl]pyrazol-5-yl]-3-(2-pyridin-3-yloxyphenyl)urea |
|---|---|
| PubChem CID | 67319044 |
| Molecular Formula | C28H32N6O5S |
| Molecular Weight | 564.67 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | 1-[3-tert-butyl-1-[3-(2-methoxyethylsulfamoyl)phenyl]pyrazol-5-yl]-3-(2-pyridin-3-yloxyphenyl)urea |
| SMILES | COCCNS(=O)(=O)c1cccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ccccc2Oc2cccnc2)c1 |
| InChI | InChI=1S/C28H32N6O5S/c1-28(2,3)25-18-26(34(33-25)20-9-7-11-22(17-20)40(36,37)30-15-16-38-4)32-27(35)31-23-12-5-6-13-24(23)39-21-10-8-14-29-19-21/h5-14,17-19,30H,15-16H2,1-4H3,(H2,31,32,35) |
| InChIKey | ZCYOPUNTZBMGRK-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 136.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.67 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|