C17H23NO4S — CID 67319367
3-[2-(2-methylcyclopropyl)ethenyl]-5-[methylsulfonyl(propyl)amino]benzoic acid (PubChem CID 67319367) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is 3-[2-(2-methylcyclopropyl)ethenyl]-5-[methylsulfonyl(propyl)amino]benzoic acid.
| Compound Name | 3-[2-(2-methylcyclopropyl)ethenyl]-5-[methylsulfonyl(propyl)amino]benzoic acid |
|---|---|
| PubChem CID | 67319367 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 3-[2-(2-methylcyclopropyl)ethenyl]-5-[methylsulfonyl(propyl)amino]benzoic acid |
| SMILES | CCCN(c1cc(C=CC2CC2C)cc(C(=O)O)c1)S(C)(=O)=O |
| InChI | InChI=1S/C17H23NO4S/c1-4-7-18(23(3,21)22)16-10-13(5-6-14-8-12(14)2)9-15(11-16)17(19)20/h5-6,9-12,14H,4,7-8H2,1-3H3,(H,19,20) |
| InChIKey | JVNFCABQNWZOOS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |