C18H22INO3 — CID 67324040
tert-butyl 7-iodo-1,1-dimethyl-3,4-dihydro-[1]benzofuro[2,3-c]pyridine-2-carboxylate (PubChem CID 67324040) has the molecular formula C18H22INO3 and a molecular weight of 427.28 g/mol. Its IUPAC name is tert-butyl 7-iodo-1,1-dimethyl-3,4-dihydro-[1]benzofuro[2,3-c]pyridine-2-carboxylate.
| Compound Name | tert-butyl 7-iodo-1,1-dimethyl-3,4-dihydro-[1]benzofuro[2,3-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 67324040 |
| Molecular Formula | C18H22INO3 |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | tert-butyl 7-iodo-1,1-dimethyl-3,4-dihydro-[1]benzofuro[2,3-c]pyridine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(oc3cc(I)ccc23)C1(C)C |
| InChI | InChI=1S/C18H22INO3/c1-17(2,3)23-16(21)20-9-8-13-12-7-6-11(19)10-14(12)22-15(13)18(20,4)5/h6-7,10H,8-9H2,1-5H3 |
| InChIKey | YLHSXEXRYXFBGE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|