C13H23BrN2O3 — CID 67330262
[(2-bromo-2-methylpropanoyl)-cyclooctylamino]carbamic acid (PubChem CID 67330262) has the molecular formula C13H23BrN2O3 and a molecular weight of 335.24 g/mol. Its IUPAC name is [(2-bromo-2-methylpropanoyl)-cyclooctylamino]carbamic acid.
| Compound Name | [(2-bromo-2-methylpropanoyl)-cyclooctylamino]carbamic acid |
|---|---|
| PubChem CID | 67330262 |
| Molecular Formula | C13H23BrN2O3 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | [(2-bromo-2-methylpropanoyl)-cyclooctylamino]carbamic acid |
| SMILES | CC(C)(Br)C(=O)N(NC(=O)O)C1CCCCCCC1 |
| InChI | InChI=1S/C13H23BrN2O3/c1-13(2,14)11(17)16(15-12(18)19)10-8-6-4-3-5-7-9-10/h10,15H,3-9H2,1-2H3,(H,18,19) |
| InChIKey | SNLFCVLZWHELKC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|