C22H40 — CID 67330757
1,2,5,6-tetramethyl-3,4,5,6-tetrapropylcyclohexa-1,3-diene (PubChem CID 67330757) has the molecular formula C22H40 and a molecular weight of 304.56 g/mol. Its IUPAC name is 1,2,5,6-tetramethyl-3,4,5,6-tetrapropylcyclohexa-1,3-diene.
| Compound Name | 1,2,5,6-tetramethyl-3,4,5,6-tetrapropylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 67330757 |
| Molecular Formula | C22H40 |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 304.31 |
| IUPAC Name | 1,2,5,6-tetramethyl-3,4,5,6-tetrapropylcyclohexa-1,3-diene |
| SMILES | CCCC1=C(CCC)C(C)(CCC)C(C)(CCC)C(C)=C1C |
| InChI | InChI=1S/C22H40/c1-9-13-19-17(5)18(6)21(7,15-11-3)22(8,16-12-4)20(19)14-10-2/h9-16H2,1-8H3 |
| InChIKey | HWEBRXLZUFEVQX-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |