C24H42 — CID 10246100
5-[(E)-but-1-enyl]-1,2,3,4,5-pentapropylcyclopenta-1,3-diene (PubChem CID 10246100) has the molecular formula C24H42 and a molecular weight of 330.60 g/mol. Its IUPAC name is 5-[(E)-but-1-enyl]-1,2,3,4,5-pentapropylcyclopenta-1,3-diene.
| Compound Name | 5-[(E)-but-1-enyl]-1,2,3,4,5-pentapropylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 10246100 |
| Molecular Formula | C24H42 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 330.33 |
| IUPAC Name | 5-[(E)-but-1-enyl]-1,2,3,4,5-pentapropylcyclopenta-1,3-diene |
| SMILES | CC/C=C/C1(CCC)C(CCC)=C(CCC)C(CCC)=C1CCC |
| InChI | InChI=1S/C24H42/c1-7-13-19-24(18-12-6)22(16-10-4)20(14-8-2)21(15-9-3)23(24)17-11-5/h13,19H,7-12,14-18H2,1-6H3/b19-13+ |
| InChIKey | HTNSLHFIEOFYGU-CPNJWEJPSA-N |
| XLogP | 8.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|