C36H56 — CID 141122196
5-cyclopenta-2,4-dien-1-yl-1,2,4,5-tetrapropyl-3-(1,2,3-tripropylcyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene (PubChem CID 141122196) has the molecular formula C36H56 and a molecular weight of 488.84 g/mol. Its IUPAC name is 5-cyclopenta-2,4-dien-1-yl-1,2,4,5-tetrapropyl-3-(1,2,3-tripropylcyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene.
| Compound Name | 5-cyclopenta-2,4-dien-1-yl-1,2,4,5-tetrapropyl-3-(1,2,3-tripropylcyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 141122196 |
| Molecular Formula | C36H56 |
| Molecular Weight | 488.84 g/mol |
| Exact Mass | 488.44 |
| IUPAC Name | 5-cyclopenta-2,4-dien-1-yl-1,2,4,5-tetrapropyl-3-(1,2,3-tripropylcyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene |
| SMILES | CCCC1=C(CCC)C(CCC)(C2=C(CCC)C(CCC)(C3C=CC=C3)C(CCC)=C2CCC)C=C1 |
| InChI | InChI=1S/C36H56/c1-8-17-28-24-27-35(25-13-6,31(28)19-10-3)34-30(18-9-2)32(20-11-4)36(26-14-7,33(34)21-12-5)29-22-15-16-23-29/h15-16,22-24,27,29H,8-14,17-21,25-26H2,1-7H3 |
| InChIKey | CTMQCMUCIZDKDB-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.84 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |