C16H11N3 — CID 67335151
4-phenyl-3H-imidazo[4,5-c]quinoline (PubChem CID 67335151) has the molecular formula C16H11N3 and a molecular weight of 245.29 g/mol. Its IUPAC name is 4-phenyl-3H-imidazo[4,5-c]quinoline.
| Compound Name | 4-phenyl-3H-imidazo[4,5-c]quinoline |
|---|---|
| PubChem CID | 67335151 |
| Molecular Formula | C16H11N3 |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 4-phenyl-3H-imidazo[4,5-c]quinoline |
| SMILES | c1ccc(-c2nc3ccccc3c3nc[nH]c23)cc1 |
| InChI | InChI=1S/C16H11N3/c1-2-6-11(7-3-1)14-16-15(17-10-18-16)12-8-4-5-9-13(12)19-14/h1-10H,(H,17,18) |
| InChIKey | CFMHSTHTLLYEJH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |