C23H19NO3 — CID 67344525
4-phenyl-2-(4-phenylbut-3-enoylamino)benzoic acid (PubChem CID 67344525) has the molecular formula C23H19NO3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-phenyl-2-(4-phenylbut-3-enoylamino)benzoic acid.
| Compound Name | 4-phenyl-2-(4-phenylbut-3-enoylamino)benzoic acid |
|---|---|
| PubChem CID | 67344525 |
| Molecular Formula | C23H19NO3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 4-phenyl-2-(4-phenylbut-3-enoylamino)benzoic acid |
| SMILES | O=C(CC=Cc1ccccc1)Nc1cc(-c2ccccc2)ccc1C(=O)O |
| InChI | InChI=1S/C23H19NO3/c25-22(13-7-10-17-8-3-1-4-9-17)24-21-16-19(14-15-20(21)23(26)27)18-11-5-2-6-12-18/h1-12,14-16H,13H2,(H,24,25)(H,26,27) |
| InChIKey | JYCOYDFFQZCLFI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |