C12H26O4 — CID 67345161
butane-1,1-diol;[3-(hydroxymethyl)cyclohexyl]methanol (PubChem CID 67345161) has the molecular formula C12H26O4 and a molecular weight of 234.34 g/mol. Its IUPAC name is butane-1,1-diol;[3-(hydroxymethyl)cyclohexyl]methanol.
| Compound Name | butane-1,1-diol;[3-(hydroxymethyl)cyclohexyl]methanol |
|---|---|
| PubChem CID | 67345161 |
| Molecular Formula | C12H26O4 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | butane-1,1-diol;[3-(hydroxymethyl)cyclohexyl]methanol |
| SMILES | CCCC(O)O.OCC1CCCC(CO)C1 |
| InChI | InChI=1S/C8H16O2.C4H10O2/c9-5-7-2-1-3-8(4-7)6-10;1-2-3-4(5)6/h7-10H,1-6H2;4-6H,2-3H2,1H3 |
| InChIKey | GBDCGVKFRWTYDI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|