C45H47N5O5 — CID 67346282
tert-butyl 3-methoxy-3-[[3-(2-propan-2-yloxy-4-pyridinyl)-1-tritylindazol-5-yl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 67346282) has the molecular formula C45H47N5O5 and a molecular weight of 737.90 g/mol. Its IUPAC name is tert-butyl 3-methoxy-3-[[3-(2-propan-2-yloxy-4-pyridinyl)-1-tritylindazol-5-yl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-methoxy-3-[[3-(2-propan-2-yloxy-4-pyridinyl)-1-tritylindazol-5-yl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67346282 |
| Molecular Formula | C45H47N5O5 |
| Molecular Weight | 737.90 g/mol |
| Exact Mass | 737.36 |
| IUPAC Name | tert-butyl 3-methoxy-3-[[3-(2-propan-2-yloxy-4-pyridinyl)-1-tritylindazol-5-yl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | COC1(C(=O)Nc2ccc3c(c2)c(-c2ccnc(OC(C)C)c2)nn3C(c2ccccc2)(c2ccccc2)c2ccccc2)CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C45H47N5O5/c1-31(2)54-39-28-32(24-26-46-39)40-37-29-36(47-41(51)44(53-6)25-27-49(30-44)42(52)55-43(3,4)5)22-23-38(37)50(48-40)45(33-16-10-7-11-17-33,34-18-12-8-13-19-34)35-20-14-9-15-21-35/h7-24,26,28-29,31H,25,27,30H2,1-6H3,(H,47,51) |
| InChIKey | ZMNXEQYVVBVHSV-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.90 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|