C45H45N5O4 — CID 67419440
tert-butyl 3-[[3-(2-cyclopropyl-4-pyridinyl)-1-tritylindazol-6-yl]carbamoyl]-3-methoxypyrrolidine-1-carboxylate (PubChem CID 67419440) has the molecular formula C45H45N5O4 and a molecular weight of 719.89 g/mol. Its IUPAC name is tert-butyl 3-[[3-(2-cyclopropyl-4-pyridinyl)-1-tritylindazol-6-yl]carbamoyl]-3-methoxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[3-(2-cyclopropyl-4-pyridinyl)-1-tritylindazol-6-yl]carbamoyl]-3-methoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67419440 |
| Molecular Formula | C45H45N5O4 |
| Molecular Weight | 719.89 g/mol |
| Exact Mass | 719.35 |
| IUPAC Name | tert-butyl 3-[[3-(2-cyclopropyl-4-pyridinyl)-1-tritylindazol-6-yl]carbamoyl]-3-methoxypyrrolidine-1-carboxylate |
| SMILES | COC1(C(=O)Nc2ccc3c(-c4ccnc(C5CC5)c4)nn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c3c2)CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C45H45N5O4/c1-43(2,3)54-42(52)49-27-25-44(30-49,53-4)41(51)47-36-22-23-37-39(29-36)50(48-40(37)32-24-26-46-38(28-32)31-20-21-31)45(33-14-8-5-9-15-33,34-16-10-6-11-17-34)35-18-12-7-13-19-35/h5-19,22-24,26,28-29,31H,20-21,25,27,30H2,1-4H3,(H,47,51) |
| InChIKey | NPZCSEDXMQSFBQ-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.89 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|