C15H11FN4O — CID 67363393
6-(2-fluorophenoxy)-5-phenyl-1,2,4-triazin-3-amine (PubChem CID 67363393) has the molecular formula C15H11FN4O and a molecular weight of 282.28 g/mol. Its IUPAC name is 6-(2-fluorophenoxy)-5-phenyl-1,2,4-triazin-3-amine.
| Compound Name | 6-(2-fluorophenoxy)-5-phenyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 67363393 |
| Molecular Formula | C15H11FN4O |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 6-(2-fluorophenoxy)-5-phenyl-1,2,4-triazin-3-amine |
| SMILES | Nc1nnc(Oc2ccccc2F)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H11FN4O/c16-11-8-4-5-9-12(11)21-14-13(18-15(17)20-19-14)10-6-2-1-3-7-10/h1-9H,(H2,17,18,20) |
| InChIKey | DKSZPFUBXGEFEK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |