C25H34N4O5 — CID 67363432
2,6-diaminohexanoic acid;[(3S,7R)-10-oxo-8-azatricyclo[5.3.1.03,8]undecan-5-yl] 1H-indole-3-carboxylate (PubChem CID 67363432) has the molecular formula C25H34N4O5 and a molecular weight of 470.57 g/mol. Its IUPAC name is 2,6-diaminohexanoic acid;[(3S,7R)-10-oxo-8-azatricyclo[5.3.1.03,8]undecan-5-yl] 1H-indole-3-carboxylate.
| Compound Name | 2,6-diaminohexanoic acid;[(3S,7R)-10-oxo-8-azatricyclo[5.3.1.03,8]undecan-5-yl] 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 67363432 |
| Molecular Formula | C25H34N4O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 2,6-diaminohexanoic acid;[(3S,7R)-10-oxo-8-azatricyclo[5.3.1.03,8]undecan-5-yl] 1H-indole-3-carboxylate |
| SMILES | NCCCCC(N)C(=O)O.O=C(OC1C[C@@H]2CC3C[C@H](C1)N2CC3=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H20N2O3.C6H14N2O2/c22-18-10-21-12-5-11(18)6-13(21)8-14(7-12)24-19(23)16-9-20-17-4-2-1-3-15(16)17;7-4-2-1-3-5(8)6(9)10/h1-4,9,11-14,20H,5-8,10H2;5H,1-4,7-8H2,(H,9,10)/t11?,12-,13+,14?; |
| InChIKey | LHKHLYHHYRDEBB-ZPQKBBRKSA-N |
| XLogP | 2.05 |
| TPSA | 151.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|