C22H22N2O6S — CID 67368709
3-[7-[(4-ethylsulfonylphenyl)methoxy]-6-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 67368709) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is 3-[7-[(4-ethylsulfonylphenyl)methoxy]-6-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[(4-ethylsulfonylphenyl)methoxy]-6-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 67368709 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 3-[7-[(4-ethylsulfonylphenyl)methoxy]-6-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCS(=O)(=O)c1ccc(COC2=C3CN(C4CCC(=O)NC4=O)C=C3C=CC2=O)cc1 |
| InChI | InChI=1S/C22H22N2O6S/c1-2-31(28,29)16-6-3-14(4-7-16)13-30-21-17-12-24(11-15(17)5-9-19(21)25)18-8-10-20(26)23-22(18)27/h3-7,9,11,18H,2,8,10,12-13H2,1H3,(H,23,26,27) |
| InChIKey | QHZUIMFUEYGBHZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|