C22H27ClO7 — CID 67382995
(2S,3R,4R,5S,6S)-2-[4-chloro-3-[1-(4-ethoxyphenyl)-2-hydroxyethyl]phenyl]-6-methoxyoxane-3,4,5-triol (PubChem CID 67382995) has the molecular formula C22H27ClO7 and a molecular weight of 438.90 g/mol. Its IUPAC name is (2S,3R,4R,5S,6S)-2-[4-chloro-3-[1-(4-ethoxyphenyl)-2-hydroxyethyl]phenyl]-6-methoxyoxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6S)-2-[4-chloro-3-[1-(4-ethoxyphenyl)-2-hydroxyethyl]phenyl]-6-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 67382995 |
| Molecular Formula | C22H27ClO7 |
| Molecular Weight | 438.90 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | (2S,3R,4R,5S,6S)-2-[4-chloro-3-[1-(4-ethoxyphenyl)-2-hydroxyethyl]phenyl]-6-methoxyoxane-3,4,5-triol |
| SMILES | CCOc1ccc(C(CO)c2cc([C@@H]3O[C@H](OC)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C22H27ClO7/c1-3-29-14-7-4-12(5-8-14)16(11-24)15-10-13(6-9-17(15)23)21-19(26)18(25)20(27)22(28-2)30-21/h4-10,16,18-22,24-27H,3,11H2,1-2H3/t16?,18-,19-,20+,21+,22+/m1/s1 |
| InChIKey | OVMYETGARVRILT-DHEHPGTOSA-N |
| XLogP | 1.99 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.90 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |