C24H30ClNO6 — CID 87190552
(2R,3R,4R,5R,6R)-2-[4-chloro-3-[C-(4-ethoxyphenyl)-N-propylcarbonimidoyl]phenyl]-6-methoxyoxane-3,4,5-triol (PubChem CID 87190552) has the molecular formula C24H30ClNO6 and a molecular weight of 463.96 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-2-[4-chloro-3-[C-(4-ethoxyphenyl)-N-propylcarbonimidoyl]phenyl]-6-methoxyoxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5R,6R)-2-[4-chloro-3-[C-(4-ethoxyphenyl)-N-propylcarbonimidoyl]phenyl]-6-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 87190552 |
| Molecular Formula | C24H30ClNO6 |
| Molecular Weight | 463.96 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | (2R,3R,4R,5R,6R)-2-[4-chloro-3-[C-(4-ethoxyphenyl)-N-propylcarbonimidoyl]phenyl]-6-methoxyoxane-3,4,5-triol |
| SMILES | CCC/N=C(\c1ccc(OCC)cc1)c1cc([C@H]2O[C@@H](OC)[C@H](O)[C@H](O)[C@H]2O)ccc1Cl |
| InChI | InChI=1S/C24H30ClNO6/c1-4-12-26-19(14-6-9-16(10-7-14)31-5-2)17-13-15(8-11-18(17)25)23-21(28)20(27)22(29)24(30-3)32-23/h6-11,13,20-24,27-29H,4-5,12H2,1-3H3/b26-19+/t20-,21-,22-,23-,24-/m1/s1 |
| InChIKey | LHLWBFUMXCKQKC-KDNDJUAXSA-N |
| XLogP | 3.11 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.96 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|