C22H28ClNO8S — CID 75992727
N-[2-[4-[[2-chloro-5-(3,4,5-trihydroxy-6-methoxyoxan-2-yl)phenyl]methyl]phenoxy]ethyl]methanesulfonamide (PubChem CID 75992727) has the molecular formula C22H28ClNO8S and a molecular weight of 501.99 g/mol. Its IUPAC name is N-[2-[4-[[2-chloro-5-(3,4,5-trihydroxy-6-methoxyoxan-2-yl)phenyl]methyl]phenoxy]ethyl]methanesulfonamide.
| Compound Name | N-[2-[4-[[2-chloro-5-(3,4,5-trihydroxy-6-methoxyoxan-2-yl)phenyl]methyl]phenoxy]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 75992727 |
| Molecular Formula | C22H28ClNO8S |
| Molecular Weight | 501.99 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | N-[2-[4-[[2-chloro-5-(3,4,5-trihydroxy-6-methoxyoxan-2-yl)phenyl]methyl]phenoxy]ethyl]methanesulfonamide |
| SMILES | COC1OC(c2ccc(Cl)c(Cc3ccc(OCCNS(C)(=O)=O)cc3)c2)C(O)C(O)C1O |
| InChI | InChI=1S/C22H28ClNO8S/c1-30-22-20(27)18(25)19(26)21(32-22)14-5-8-17(23)15(12-14)11-13-3-6-16(7-4-13)31-10-9-24-33(2,28)29/h3-8,12,18-22,24-27H,9-11H2,1-2H3 |
| InChIKey | NBMXNIYPOCHLBR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.99 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|