C23H28ClNO7 — CID 89451490
(3R,4R,5S,6S)-2-[4-chloro-3-[[4-[(3E)-3-methoxyiminopropoxy]phenyl]methyl]phenyl]-6-methoxyoxane-3,4,5-triol (PubChem CID 89451490) has the molecular formula C23H28ClNO7 and a molecular weight of 465.93 g/mol. Its IUPAC name is (3R,4R,5S,6S)-2-[4-chloro-3-[[4-[(3E)-3-methoxyiminopropoxy]phenyl]methyl]phenyl]-6-methoxyoxane-3,4,5-triol.
| Compound Name | (3R,4R,5S,6S)-2-[4-chloro-3-[[4-[(3E)-3-methoxyiminopropoxy]phenyl]methyl]phenyl]-6-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 89451490 |
| Molecular Formula | C23H28ClNO7 |
| Molecular Weight | 465.93 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | (3R,4R,5S,6S)-2-[4-chloro-3-[[4-[(3E)-3-methoxyiminopropoxy]phenyl]methyl]phenyl]-6-methoxyoxane-3,4,5-triol |
| SMILES | CO/N=C/CCOc1ccc(Cc2cc(C3O[C@H](OC)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H28ClNO7/c1-29-23-21(28)19(26)20(27)22(32-23)15-6-9-18(24)16(13-15)12-14-4-7-17(8-5-14)31-11-3-10-25-30-2/h4-10,13,19-23,26-28H,3,11-12H2,1-2H3/b25-10+/t19-,20-,21+,22?,23+/m1/s1 |
| InChIKey | RJWWRZXMQMSIOI-JPLPYJQTSA-N |
| XLogP | 2.46 |
| TPSA | 109.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.93 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|