C24H30ClNO6 — CID 66885400
(2S,3R,4R,5S)-2-[4-chloro-3-[[4-(1-methylpyrrolidin-3-yl)oxyphenyl]methyl]phenyl]-6-methoxyoxane-3,4,5-triol (PubChem CID 66885400) has the molecular formula C24H30ClNO6 and a molecular weight of 463.96 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2-[4-chloro-3-[[4-(1-methylpyrrolidin-3-yl)oxyphenyl]methyl]phenyl]-6-methoxyoxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S)-2-[4-chloro-3-[[4-(1-methylpyrrolidin-3-yl)oxyphenyl]methyl]phenyl]-6-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 66885400 |
| Molecular Formula | C24H30ClNO6 |
| Molecular Weight | 463.96 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | (2S,3R,4R,5S)-2-[4-chloro-3-[[4-(1-methylpyrrolidin-3-yl)oxyphenyl]methyl]phenyl]-6-methoxyoxane-3,4,5-triol |
| SMILES | COC1O[C@@H](c2ccc(Cl)c(Cc3ccc(OC4CCN(C)C4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H30ClNO6/c1-26-10-9-18(13-26)31-17-6-3-14(4-7-17)11-16-12-15(5-8-19(16)25)23-21(28)20(27)22(29)24(30-2)32-23/h3-8,12,18,20-24,27-29H,9-11,13H2,1-2H3/t18?,20-,21-,22+,23+,24?/m1/s1 |
| InChIKey | DSIZXWXUMBOCLV-PDGGGQAASA-N |
| XLogP | 2.14 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.96 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |