C21H23ClO7 — CID 45485093
[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]phenyl]-(4-ethoxyphenyl)methanone (PubChem CID 45485093) has the molecular formula C21H23ClO7 and a molecular weight of 422.86 g/mol. Its IUPAC name is [2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]phenyl]-(4-ethoxyphenyl)methanone.
| Compound Name | [2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]phenyl]-(4-ethoxyphenyl)methanone |
|---|---|
| PubChem CID | 45485093 |
| Molecular Formula | C21H23ClO7 |
| Molecular Weight | 422.86 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | [2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]phenyl]-(4-ethoxyphenyl)methanone |
| SMILES | CCOc1ccc(C(=O)c2cc([C@@H]3O[C@@H](OC)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H23ClO7/c1-3-28-13-7-4-11(5-8-13)16(23)14-10-12(6-9-15(14)22)20-18(25)17(24)19(26)21(27-2)29-20/h4-10,17-21,24-26H,3H2,1-2H3/t17-,18-,19+,20+,21-/m1/s1 |
| InChIKey | JDGRCNIETMIZNO-CRSSMBPESA-N |
| XLogP | 2.10 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.86 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |