C23H24F3N3O5S — CID 67393735
N-(2-phenoxyethyl)-8-[3-(trifluoromethyl)phenyl]sulfonyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxamide (PubChem CID 67393735) has the molecular formula C23H24F3N3O5S and a molecular weight of 511.52 g/mol. Its IUPAC name is N-(2-phenoxyethyl)-8-[3-(trifluoromethyl)phenyl]sulfonyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxamide.
| Compound Name | N-(2-phenoxyethyl)-8-[3-(trifluoromethyl)phenyl]sulfonyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxamide |
|---|---|
| PubChem CID | 67393735 |
| Molecular Formula | C23H24F3N3O5S |
| Molecular Weight | 511.52 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | N-(2-phenoxyethyl)-8-[3-(trifluoromethyl)phenyl]sulfonyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)C1=NOC2(CCN(S(=O)(=O)c3cccc(C(F)(F)F)c3)CC2)C1 |
| InChI | InChI=1S/C23H24F3N3O5S/c24-23(25,26)17-5-4-8-19(15-17)35(31,32)29-12-9-22(10-13-29)16-20(28-34-22)21(30)27-11-14-33-18-6-2-1-3-7-18/h1-8,15H,9-14,16H2,(H,27,30) |
| InChIKey | UYZGSZHEWBOAEN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|