C26H41N3O3 — CID 67401190
[(4S)-1-[[(3aR,4S,6aS)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-4,6,6-trimethyl-5-oxoheptan-2-yl]-methylcarbamic acid (PubChem CID 67401190) has the molecular formula C26H41N3O3 and a molecular weight of 443.63 g/mol. Its IUPAC name is [(4S)-1-[[(3aR,4S,6aS)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-4,6,6-trimethyl-5-oxoheptan-2-yl]-methylcarbamic acid.
| Compound Name | [(4S)-1-[[(3aR,4S,6aS)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-4,6,6-trimethyl-5-oxoheptan-2-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 67401190 |
| Molecular Formula | C26H41N3O3 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.31 |
| IUPAC Name | [(4S)-1-[[(3aR,4S,6aS)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-4,6,6-trimethyl-5-oxoheptan-2-yl]-methylcarbamic acid |
| SMILES | C[C@@H](CC(CN[C@H]1CC[C@@H]2CN(Cc3ccccc3)C[C@@H]21)N(C)C(=O)O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C26H41N3O3/c1-18(24(30)26(2,3)4)13-21(28(5)25(31)32)14-27-23-12-11-20-16-29(17-22(20)23)15-19-9-7-6-8-10-19/h6-10,18,20-23,27H,11-17H2,1-5H3,(H,31,32)/t18-,20+,21?,22-,23-/m0/s1 |
| InChIKey | LRTHRISTGPUJOL-QIZPQMCYSA-N |
| XLogP | 4.11 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |