C21H31N3O3 — CID 87497671
[[(3aS,4R,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino] N-methyl-N-[(2S)-5-oxopentan-2-yl]carbamate (PubChem CID 87497671) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is [[(3aS,4R,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino] N-methyl-N-[(2S)-5-oxopentan-2-yl]carbamate.
| Compound Name | [[(3aS,4R,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino] N-methyl-N-[(2S)-5-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 87497671 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | [[(3aS,4R,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino] N-methyl-N-[(2S)-5-oxopentan-2-yl]carbamate |
| SMILES | C[C@@H](CCC=O)N(C)C(=O)ON[C@@H]1CC[C@H]2CN(Cc3ccccc3)C[C@H]21 |
| InChI | InChI=1S/C21H31N3O3/c1-16(7-6-12-25)23(2)21(26)27-22-20-11-10-18-14-24(15-19(18)20)13-17-8-4-3-5-9-17/h3-5,8-9,12,16,18-20,22H,6-7,10-11,13-15H2,1-2H3/t16-,18-,19+,20+/m0/s1 |
| InChIKey | TWAGULNMNQMDKG-IJXRJRJASA-N |
| XLogP | 2.84 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|