C17H15FN2O3 — CID 67404871
2-[2-(5-fluoro-2-methylanilino)-1,3-benzoxazol-6-yl]propanoic acid (PubChem CID 67404871) has the molecular formula C17H15FN2O3 and a molecular weight of 314.32 g/mol. Its IUPAC name is 2-[2-(5-fluoro-2-methylanilino)-1,3-benzoxazol-6-yl]propanoic acid.
| Compound Name | 2-[2-(5-fluoro-2-methylanilino)-1,3-benzoxazol-6-yl]propanoic acid |
|---|---|
| PubChem CID | 67404871 |
| Molecular Formula | C17H15FN2O3 |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 2-[2-(5-fluoro-2-methylanilino)-1,3-benzoxazol-6-yl]propanoic acid |
| SMILES | Cc1ccc(F)cc1Nc1nc2ccc(C(C)C(=O)O)cc2o1 |
| InChI | InChI=1S/C17H15FN2O3/c1-9-3-5-12(18)8-14(9)20-17-19-13-6-4-11(7-15(13)23-17)10(2)16(21)22/h3-8,10H,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | MXCCCEJPYIWHIZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |