C23H30ClNO3 — CID 67409699
(1-methylpiperidin-4-yl) 2-(1,1-diphenylpropoxy)acetate;hydrochloride (PubChem CID 67409699) has the molecular formula C23H30ClNO3 and a molecular weight of 403.95 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) 2-(1,1-diphenylpropoxy)acetate;hydrochloride.
| Compound Name | (1-methylpiperidin-4-yl) 2-(1,1-diphenylpropoxy)acetate;hydrochloride |
|---|---|
| PubChem CID | 67409699 |
| Molecular Formula | C23H30ClNO3 |
| Molecular Weight | 403.95 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | (1-methylpiperidin-4-yl) 2-(1,1-diphenylpropoxy)acetate;hydrochloride |
| SMILES | CCC(OCC(=O)OC1CCN(C)CC1)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C23H29NO3.ClH/c1-3-23(19-10-6-4-7-11-19,20-12-8-5-9-13-20)26-18-22(25)27-21-14-16-24(2)17-15-21;/h4-13,21H,3,14-18H2,1-2H3;1H |
| InChIKey | SMAPETDENWTQTF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.95 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |