C14H17IO3 — CID 67413627
6-[3-(3-iodopropoxy)prop-1-enyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 67413627) has the molecular formula C14H17IO3 and a molecular weight of 360.19 g/mol. Its IUPAC name is 6-[3-(3-iodopropoxy)prop-1-enyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-[3-(3-iodopropoxy)prop-1-enyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 67413627 |
| Molecular Formula | C14H17IO3 |
| Molecular Weight | 360.19 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 6-[3-(3-iodopropoxy)prop-1-enyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | ICCCOCC=Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C14H17IO3/c15-6-2-8-16-7-1-3-12-4-5-13-14(11-12)18-10-9-17-13/h1,3-5,11H,2,6-10H2 |
| InChIKey | RCDCLKCCVOAGJD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.19 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|