C13H17N3O3 — CID 67415578
(8bS)-3,4,8b-trimethyl-5-nitro-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-ol (PubChem CID 67415578) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is (8bS)-3,4,8b-trimethyl-5-nitro-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-ol.
| Compound Name | (8bS)-3,4,8b-trimethyl-5-nitro-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-ol |
|---|---|
| PubChem CID | 67415578 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (8bS)-3,4,8b-trimethyl-5-nitro-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-ol |
| SMILES | CN1CC[C@@]2(C)c3cc(O)cc([N+](=O)[O-])c3N(C)C12 |
| InChI | InChI=1S/C13H17N3O3/c1-13-4-5-14(2)12(13)15(3)11-9(13)6-8(17)7-10(11)16(18)19/h6-7,12,17H,4-5H2,1-3H3/t12?,13-/m0/s1 |
| InChIKey | HNVMNWLORFVHPN-ABLWVSNPSA-N |
| XLogP | 1.67 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|