About 3-(1H-indazol-5-yl)-1,2,5-oxadiazole
3-(1H-indazol-5-yl)-1,2,5-oxadiazole (PubChem CID 67417343) has the molecular formula C9H6N4O
and a molecular weight of 186.17 g/mol. Its IUPAC name is 3-(1H-indazol-5-yl)-1,2,5-oxadiazole.
Molecular Properties
| Compound Name | 3-(1H-indazol-5-yl)-1,2,5-oxadiazole |
| PubChem CID | 67417343 |
| Molecular Formula | C9H6N4O |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 3-(1H-indazol-5-yl)-1,2,5-oxadiazole |
| SMILES | c1cc2[nH]ncc2cc1-c1cnon1 |
| InChI | InChI=1S/C9H6N4O/c1-2-8-7(4-10-12-8)3-6(1)9-5-11-14-13-9/h1-5H,(H,10,12) |
| InChIKey | IXKAZEAACFQTTQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1H-indazol-5-yl)-1,2,5-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-indazol-5-yl)-1,2,5-oxadiazole?
The IUPAC name of 3-(1H-indazol-5-yl)-1,2,5-oxadiazole (CID 67417343) is 3-(1H-indazol-5-yl)-1,2,5-oxadiazole.
What is the SMILES notation for 3-(1H-indazol-5-yl)-1,2,5-oxadiazole?
The canonical SMILES for 3-(1H-indazol-5-yl)-1,2,5-oxadiazole is c1cc2[nH]ncc2cc1-c1cnon1.
What is the InChIKey of 3-(1H-indazol-5-yl)-1,2,5-oxadiazole?
The InChIKey is IXKAZEAACFQTTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N4O/c1-2-8-7(4-10-12-8)3-6(1)9-5-11-14-13-9/h1-5H,(H,10,12).
What are the key properties of 3-(1H-indazol-5-yl)-1,2,5-oxadiazole?
3-(1H-indazol-5-yl)-1,2,5-oxadiazole has a molecular weight of 186.17 g/mol, XLogP of 1.61, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-indazol-5-yl)-1,2,5-oxadiazole is sourced from PubChem (CID 67417343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).