C12H11ClF3NO5 — CID 67426563
methyl 2-[(2-chlorobenzoyl)amino]-4,4,4-trifluoro-3,3-dihydroxybutanoate (PubChem CID 67426563) has the molecular formula C12H11ClF3NO5 and a molecular weight of 341.67 g/mol. Its IUPAC name is methyl 2-[(2-chlorobenzoyl)amino]-4,4,4-trifluoro-3,3-dihydroxybutanoate.
| Compound Name | methyl 2-[(2-chlorobenzoyl)amino]-4,4,4-trifluoro-3,3-dihydroxybutanoate |
|---|---|
| PubChem CID | 67426563 |
| Molecular Formula | C12H11ClF3NO5 |
| Molecular Weight | 341.67 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | methyl 2-[(2-chlorobenzoyl)amino]-4,4,4-trifluoro-3,3-dihydroxybutanoate |
| SMILES | COC(=O)C(NC(=O)c1ccccc1Cl)C(O)(O)C(F)(F)F |
| InChI | InChI=1S/C12H11ClF3NO5/c1-22-10(19)8(11(20,21)12(14,15)16)17-9(18)6-4-2-3-5-7(6)13/h2-5,8,20-21H,1H3,(H,17,18) |
| InChIKey | OKMUOOIZODUMQG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.67 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|