C15H19NO4 — CID 67440846
[(1R)-1-[(2S)-2,5-dihydrofuran-2-yl]-1-methoxy-3-phenylpropan-2-yl] carbamate (PubChem CID 67440846) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is [(1R)-1-[(2S)-2,5-dihydrofuran-2-yl]-1-methoxy-3-phenylpropan-2-yl] carbamate.
| Compound Name | [(1R)-1-[(2S)-2,5-dihydrofuran-2-yl]-1-methoxy-3-phenylpropan-2-yl] carbamate |
|---|---|
| PubChem CID | 67440846 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | [(1R)-1-[(2S)-2,5-dihydrofuran-2-yl]-1-methoxy-3-phenylpropan-2-yl] carbamate |
| SMILES | CO[C@H](C(Cc1ccccc1)OC(N)=O)[C@@H]1C=CCO1 |
| InChI | InChI=1S/C15H19NO4/c1-18-14(12-8-5-9-19-12)13(20-15(16)17)10-11-6-3-2-4-7-11/h2-8,12-14H,9-10H2,1H3,(H2,16,17)/t12-,13?,14-/m0/s1 |
| InChIKey | IIKTYAUSPCTOTN-HPNRGHHYSA-N |
| XLogP | 1.66 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|