C29H32F4N2O5S — CID 67441547
N-[4-[2-butoxy-4-(trifluoromethyl)phenyl]-2-[3-fluoro-4-(methanesulfonamido)phenyl]butyl]-2-hydroxybenzamide (PubChem CID 67441547) has the molecular formula C29H32F4N2O5S and a molecular weight of 596.64 g/mol. Its IUPAC name is N-[4-[2-butoxy-4-(trifluoromethyl)phenyl]-2-[3-fluoro-4-(methanesulfonamido)phenyl]butyl]-2-hydroxybenzamide.
| Compound Name | N-[4-[2-butoxy-4-(trifluoromethyl)phenyl]-2-[3-fluoro-4-(methanesulfonamido)phenyl]butyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 67441547 |
| Molecular Formula | C29H32F4N2O5S |
| Molecular Weight | 596.64 g/mol |
| Exact Mass | 596.20 |
| IUPAC Name | N-[4-[2-butoxy-4-(trifluoromethyl)phenyl]-2-[3-fluoro-4-(methanesulfonamido)phenyl]butyl]-2-hydroxybenzamide |
| SMILES | CCCCOc1cc(C(F)(F)F)ccc1CCC(CNC(=O)c1ccccc1O)c1ccc(NS(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C29H32F4N2O5S/c1-3-4-15-40-27-17-22(29(31,32)33)13-11-19(27)9-10-21(18-34-28(37)23-7-5-6-8-26(23)36)20-12-14-25(24(30)16-20)35-41(2,38)39/h5-8,11-14,16-17,21,35-36H,3-4,9-10,15,18H2,1-2H3,(H,34,37) |
| InChIKey | RFAKOZOZFHIFMU-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.64 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|