C22H26F4N2O3S — CID 141331971
N-[[2-butoxy-4-(trifluoromethyl)phenyl]methyl]-2-[3-fluoro-4-(methanesulfinamido)phenyl]propanamide (PubChem CID 141331971) has the molecular formula C22H26F4N2O3S and a molecular weight of 474.52 g/mol. Its IUPAC name is N-[[2-butoxy-4-(trifluoromethyl)phenyl]methyl]-2-[3-fluoro-4-(methanesulfinamido)phenyl]propanamide.
| Compound Name | N-[[2-butoxy-4-(trifluoromethyl)phenyl]methyl]-2-[3-fluoro-4-(methanesulfinamido)phenyl]propanamide |
|---|---|
| PubChem CID | 141331971 |
| Molecular Formula | C22H26F4N2O3S |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | N-[[2-butoxy-4-(trifluoromethyl)phenyl]methyl]-2-[3-fluoro-4-(methanesulfinamido)phenyl]propanamide |
| SMILES | CCCCOc1cc(C(F)(F)F)ccc1CNC(=O)C(C)c1ccc(NS(C)=O)c(F)c1 |
| InChI | InChI=1S/C22H26F4N2O3S/c1-4-5-10-31-20-12-17(22(24,25)26)8-6-16(20)13-27-21(29)14(2)15-7-9-19(18(23)11-15)28-32(3)30/h6-9,11-12,14,28H,4-5,10,13H2,1-3H3,(H,27,29) |
| InChIKey | VJCNPJNKNSOCPO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|