C13H25N3S — CID 67451395
3,4-di(piperidin-1-yl)-1,3-thiazolidine (PubChem CID 67451395) has the molecular formula C13H25N3S and a molecular weight of 255.43 g/mol. Its IUPAC name is 3,4-di(piperidin-1-yl)-1,3-thiazolidine.
| Compound Name | 3,4-di(piperidin-1-yl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 67451395 |
| Molecular Formula | C13H25N3S |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 3,4-di(piperidin-1-yl)-1,3-thiazolidine |
| SMILES | C1CCN(C2CSCN2N2CCCCC2)CC1 |
| InChI | InChI=1S/C13H25N3S/c1-3-7-14(8-4-1)13-11-17-12-16(13)15-9-5-2-6-10-15/h13H,1-12H2 |
| InChIKey | QEHWJWIQPNUTKQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |