C13H25N3 — CID 68510869
1,2-dipyrrolidin-1-ylpiperidine (PubChem CID 68510869) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is 1,2-dipyrrolidin-1-ylpiperidine.
| Compound Name | 1,2-dipyrrolidin-1-ylpiperidine |
|---|---|
| PubChem CID | 68510869 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 1,2-dipyrrolidin-1-ylpiperidine |
| SMILES | C1CCN(N2CCCC2)C(N2CCCC2)C1 |
| InChI | InChI=1S/C13H25N3/c1-2-12-16(15-10-5-6-11-15)13(7-1)14-8-3-4-9-14/h13H,1-12H2 |
| InChIKey | VISJOKHDDONXQR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |