About tert-butyl (5S)-6-ethoxy-5-methyl-3,5-dihydro-2H-pyrazine-4-carboxylate
tert-butyl (5S)-6-ethoxy-5-methyl-3,5-dihydro-2H-pyrazine-4-carboxylate (PubChem CID 67451786) has the molecular formula C12H22N2O3
and a molecular weight of 242.32 g/mol. Its IUPAC name is tert-butyl (5S)-6-ethoxy-5-methyl-3,5-dihydro-2H-pyrazine-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (5S)-6-ethoxy-5-methyl-3,5-dihydro-2H-pyrazine-4-carboxylate |
| PubChem CID | 67451786 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | tert-butyl (5S)-6-ethoxy-5-methyl-3,5-dihydro-2H-pyrazine-4-carboxylate |
| SMILES | CCOC1=NCCN(C(=O)OC(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C12H22N2O3/c1-6-16-10-9(2)14(8-7-13-10)11(15)17-12(3,4)5/h9H,6-8H2,1-5H3/t9-/m0/s1 |
| InChIKey | VQXLQBCWWLKVDP-VIFPVBQESA-N |
| XLogP | 2.06 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (5S)-6-ethoxy-5-methyl-3,5-dihydro-2H-pyrazine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (5S)-6-ethoxy-5-methyl-3,5-dihydro-2H-pyrazine-4-carboxylate?
The IUPAC name of tert-butyl (5S)-6-ethoxy-5-methyl-3,5-dihydro-2H-pyrazine-4-carboxylate (CID 67451786) is tert-butyl (5S)-6-ethoxy-5-methyl-3,5-dihydro-2H-pyrazine-4-carboxylate.
What is the SMILES notation for tert-butyl (5S)-6-ethoxy-5-methyl-3,5-dihydro-2H-pyrazine-4-carboxylate?
The canonical SMILES for tert-butyl (5S)-6-ethoxy-5-methyl-3,5-dihydro-2H-pyrazine-4-carboxylate is CCOC1=NCCN(C(=O)OC(C)(C)C)[C@H]1C.
What is the InChIKey of tert-butyl (5S)-6-ethoxy-5-methyl-3,5-dihydro-2H-pyrazine-4-carboxylate?
The InChIKey is VQXLQBCWWLKVDP-VIFPVBQESA-N. The full InChI is InChI=1S/C12H22N2O3/c1-6-16-10-9(2)14(8-7-13-10)11(15)17-12(3,4)5/h9H,6-8H2,1-5H3/t9-/m0/s1.
What are the key properties of tert-butyl (5S)-6-ethoxy-5-methyl-3,5-dihydro-2H-pyrazine-4-carboxylate?
tert-butyl (5S)-6-ethoxy-5-methyl-3,5-dihydro-2H-pyrazine-4-carboxylate has a molecular weight of 242.32 g/mol, XLogP of 2.06, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (5S)-6-ethoxy-5-methyl-3,5-dihydro-2H-pyrazine-4-carboxylate is sourced from PubChem (CID 67451786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).