C21H26N2O3 — CID 67461888
3-[2-[[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]methoxy]cyclohexyl]oxypropanenitrile (PubChem CID 67461888) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 3-[2-[[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]methoxy]cyclohexyl]oxypropanenitrile.
| Compound Name | 3-[2-[[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]methoxy]cyclohexyl]oxypropanenitrile |
|---|---|
| PubChem CID | 67461888 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 3-[2-[[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]methoxy]cyclohexyl]oxypropanenitrile |
| SMILES | Cc1cccc(-c2nc(COC3CCCCC3OCCC#N)c(C)o2)c1 |
| InChI | InChI=1S/C21H26N2O3/c1-15-7-5-8-17(13-15)21-23-18(16(2)26-21)14-25-20-10-4-3-9-19(20)24-12-6-11-22/h5,7-8,13,19-20H,3-4,6,9-10,12,14H2,1-2H3 |
| InChIKey | VOWVGGLRUMACMC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|