C17H17N3O2 — CID 67472411
ethyl 8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2,4,6,13,15-hexaene-9-carboxylate (PubChem CID 67472411) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is ethyl 8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2,4,6,13,15-hexaene-9-carboxylate.
| Compound Name | ethyl 8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2,4,6,13,15-hexaene-9-carboxylate |
|---|---|
| PubChem CID | 67472411 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | ethyl 8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2,4,6,13,15-hexaene-9-carboxylate |
| SMILES | CCOC(=O)C1Nc2ccccc2-c2ccnc3c2C1CN3 |
| InChI | InChI=1S/C17H17N3O2/c1-2-22-17(21)15-12-9-19-16-14(12)11(7-8-18-16)10-5-3-4-6-13(10)20-15/h3-8,12,15,20H,2,9H2,1H3,(H,18,19) |
| InChIKey | VDSCQEWXUBNLGG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |