C29H33IN2O3 — CID 67486559
tert-butyl 4-[[1-(4-tert-butylphenyl)-2-(4-iodoanilino)-2-oxoethyl]amino]benzoate (PubChem CID 67486559) has the molecular formula C29H33IN2O3 and a molecular weight of 584.50 g/mol. Its IUPAC name is tert-butyl 4-[[1-(4-tert-butylphenyl)-2-(4-iodoanilino)-2-oxoethyl]amino]benzoate.
| Compound Name | tert-butyl 4-[[1-(4-tert-butylphenyl)-2-(4-iodoanilino)-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 67486559 |
| Molecular Formula | C29H33IN2O3 |
| Molecular Weight | 584.50 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | tert-butyl 4-[[1-(4-tert-butylphenyl)-2-(4-iodoanilino)-2-oxoethyl]amino]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(NC(C(=O)Nc2ccc(I)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H33IN2O3/c1-28(2,3)21-11-7-19(8-12-21)25(26(33)32-24-17-13-22(30)14-18-24)31-23-15-9-20(10-16-23)27(34)35-29(4,5)6/h7-18,25,31H,1-6H3,(H,32,33) |
| InChIKey | KAJQPUJDPOLVIZ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.50 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|