C26H32F2N4O4 — CID 67494379
(1S,11S,15S)-N-[(2,4-difluorophenyl)methyl]-7-hydroxy-17-(2-methylpropyl)-6,9-dioxo-3,10,17-triazatetracyclo[8.7.0.03,8.011,15]heptadec-7-ene-5-carboxamide (PubChem CID 67494379) has the molecular formula C26H32F2N4O4 and a molecular weight of 502.56 g/mol. Its IUPAC name is (1S,11S,15S)-N-[(2,4-difluorophenyl)methyl]-7-hydroxy-17-(2-methylpropyl)-6,9-dioxo-3,10,17-triazatetracyclo[8.7.0.03,8.011,15]heptadec-7-ene-5-carboxamide.
| Compound Name | (1S,11S,15S)-N-[(2,4-difluorophenyl)methyl]-7-hydroxy-17-(2-methylpropyl)-6,9-dioxo-3,10,17-triazatetracyclo[8.7.0.03,8.011,15]heptadec-7-ene-5-carboxamide |
|---|---|
| PubChem CID | 67494379 |
| Molecular Formula | C26H32F2N4O4 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | (1S,11S,15S)-N-[(2,4-difluorophenyl)methyl]-7-hydroxy-17-(2-methylpropyl)-6,9-dioxo-3,10,17-triazatetracyclo[8.7.0.03,8.011,15]heptadec-7-ene-5-carboxamide |
| SMILES | CC(C)CN1C[C@@H]2CCC[C@@H]2N2C(=O)C3=C(O)C(=O)C(C(=O)NCc4ccc(F)cc4F)CN3C[C@@H]12 |
| InChI | InChI=1S/C26H32F2N4O4/c1-14(2)10-30-11-16-4-3-5-20(16)32-21(30)13-31-12-18(23(33)24(34)22(31)26(32)36)25(35)29-9-15-6-7-17(27)8-19(15)28/h6-8,14,16,18,20-21,34H,3-5,9-13H2,1-2H3,(H,29,35)/t16-,18?,20-,21-/m0/s1 |
| InChIKey | FKBNRGGIGNMMKZ-RPKRAUFMSA-N |
| XLogP | 2.16 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|